cas: 884495-14-1 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxy-4-methyl-3-nitropyridine, 96% (CAS 884495-14-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036247-1G |
| cas | 884495-14-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 310.33 Pln | |
| Fluorochem | 100g | 1044.44 Pln | |
| Fluorochem | 500g | 5001.38 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-methoxy-4-methyl-3-nitropyridine (CAS 884495-14-1) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 5-bromo-2-methoxy-4-methyl-3-nitropyridine. InChIKey: BGDKJBCVNNWITN-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 5-bromo-2-methoxy-4-methyl-3-nitropyridine |
| InChIKey | BGDKJBCVNNWITN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1Br)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)