cas: 884495-14-1 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxy-4-methyl-3-nitropyridine, 97%, 97% (CAS 884495-14-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115EM7-250mg |
| cas | 884495-14-1 |
| size | 250mg |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 50g | 381.20 Pln | |
| Chemat | 100g | 683.60 Pln | |
| Chemat | 250g | 1576.40 Pln | |
| Chemat | 500g | 3028.80 Pln | |
| Chemat | 1kg | 5694.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-methoxy-4-methyl-3-nitropyridine (CAS 884495-14-1) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 5-bromo-2-methoxy-4-methyl-3-nitropyridine. InChIKey: BGDKJBCVNNWITN-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 5-bromo-2-methoxy-4-methyl-3-nitropyridine |
| InChIKey | BGDKJBCVNNWITN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1Br)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)