CAS 1261438-84-9 appears in our catalog under these names: 3-Bromo-5-methoxybenzenesulfonamide, 97%, 3-Bromo-5-methoxybenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-bromo-5-methoxybenzenesulfonamide (CAS 1261438-84-9) is a chemical compound with the molecular formula C7H8BrNO3S and a molecular weight of 266.11 g/mol. IUPAC name: 3-bromo-5-methoxybenzenesulfonamide. InChIKey: MIOYHODZZFACDK-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO3S |
|---|---|
| Molecular weight | 266.11 g/mol |
| IUPAC name | 3-bromo-5-methoxybenzenesulfonamide |
| InChIKey | MIOYHODZZFACDK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)