Products 2648455-21-2

CAS 2648455-21-2 is the registry number for 2-Bromo-5-(2-hydroxypropan-2-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-bromo-5-(2-hydroxypropan-2-yl)-1,3-thiazole-4-carboxylic acid (CAS 2648455-21-2) is a chemical compound with the molecular formula C7H8BrNO3S and a molecular weight of 266.11 g/mol. IUPAC name: 2-bromo-5-(2-hydroxypropan-2-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: IQGCUAUEPWCSHT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BrNO3S
Molecular weight266.11 g/mol
IUPAC name2-bromo-5-(2-hydroxypropan-2-yl)-1,3-thiazole-4-carboxylic acid
InChIKeyIQGCUAUEPWCSHT-UHFFFAOYSA-N
SMILESCC(C)(C1=C(N=C(S1)Br)C(=O)O)O

Computed by PubChem (NCBI)