cas: 23095-05-8 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxybenzenesulfonyl chloride 98% (CAS 23095-05-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A380584-25g |
| cas | 23095-05-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 743.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A380584 |
5-bromo-2-methoxybenzenesulfonyl chloride (CAS 23095-05-8) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 5-bromo-2-methoxybenzenesulfonyl chloride. InChIKey: IXSBNNRUQYYMRM-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 5-bromo-2-methoxybenzenesulfonyl chloride |
| InChIKey | IXSBNNRUQYYMRM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)