cas: 23095-05-8 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxybenzenesulfonyl chloride, 95% (CAS 23095-05-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212827-1G |
| cas | 23095-05-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 25g | 190.58 Pln | |
| Fluorochem | 100g | 581.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-methoxybenzenesulfonyl chloride (CAS 23095-05-8) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 5-bromo-2-methoxybenzenesulfonyl chloride. InChIKey: IXSBNNRUQYYMRM-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 5-bromo-2-methoxybenzenesulfonyl chloride |
| InChIKey | IXSBNNRUQYYMRM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)