cas: 89642-50-2 — see every product listed under this CAS number, including other names
5-Bromo-2-nitrobenzonitrile, 95% (CAS 89642-50-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225353-1G |
| cas | 89642-50-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 346.77 Pln | |
| Fluorochem | 100g | 1205.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-bromo-2-nitrobenzonitrile (CAS 89642-50-2) is a chemical compound with the molecular formula C7H3BrN2O2 and a molecular weight of 227.01 g/mol. IUPAC name: 5-bromo-2-nitrobenzonitrile. InChIKey: LCNNOEPOXHHUQG-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2 |
|---|---|
| Molecular weight | 227.01 g/mol |
| IUPAC name | 5-bromo-2-nitrobenzonitrile |
| InChIKey | LCNNOEPOXHHUQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)