Products 1805598-60-0

CAS 1805598-60-0 is the registry number for 3-Bromo-5-cyanopicolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-bromo-5-cyanopyridine-2-carboxylic acid (CAS 1805598-60-0) is a chemical compound with the molecular formula C7H3BrN2O2 and a molecular weight of 227.01 g/mol. IUPAC name: 3-bromo-5-cyanopyridine-2-carboxylic acid. InChIKey: SGNAPZQQLKYXNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3BrN2O2
Molecular weight227.01 g/mol
IUPAC name3-bromo-5-cyanopyridine-2-carboxylic acid
InChIKeySGNAPZQQLKYXNJ-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Br)C(=O)O)C#N

Computed by PubChem (NCBI)