cas: 57356-64-6 — see every product listed under this CAS number, including other names
5-Bromo-2-piperidin-1-ylpyrimidine, 95% (CAS 57356-64-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F067435-1G |
| cas | 57356-64-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 25g | 560.24 Pln | |
| Fluorochem | 100g | 2059.71 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-piperidin-1-ylpyrimidine (CAS 57356-64-6) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 5-bromo-2-piperidin-1-ylpyrimidine. InChIKey: OSEFZQJCFCWHKB-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 5-bromo-2-piperidin-1-ylpyrimidine |
| InChIKey | OSEFZQJCFCWHKB-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)