cas: 82299-36-3 — see every product listed under this CAS number, including other names
5-Bromo-2H-1,3-benzodioxol-4-ol, 98%, 98% (CAS 82299-36-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132Q2T-100mg |
| cas | 82299-36-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 846.80 Pln | |
| Chemat | 1g | 1634.00 Pln | |
| Chemat | 5g | 5690.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1,3-benzodioxol-4-ol (CAS 82299-36-3) is a chemical compound with the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. IUPAC name: 5-bromo-1,3-benzodioxol-4-ol. InChIKey: FSDSDUFDWODBBX-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO3 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 5-bromo-1,3-benzodioxol-4-ol |
| InChIKey | FSDSDUFDWODBBX-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)O |
Computed by PubChem (NCBI)