Products 111252-31-4
CAS 111252-31-4 appears in our catalog under these names: 3-(5-Bromo-furan-2-yl)-acrylic acid, 95%, (2E)-3-(5-Bromofuran-2-yl)prop-2-enoic acid, (E)-3-(5-Bromofuran-2-yl)acrylic acid 97%, (E)-3-(5-Bromofuran-2-yl)acrylic acid, 97%, 97%, (2E)-3-(5-BROMOFURAN-2-YL)PROP-2-ENOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-3-(5-bromofuran-2-yl)prop-2-enoic acid (CAS 111252-31-4) is a chemical compound with the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. IUPAC name: (E)-3-(5-bromofuran-2-yl)prop-2-enoic acid. InChIKey: IIMYTCICBUBFJH-DUXPYHPUSA-N.
| Molecular formula | C7H5BrO3 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | (E)-3-(5-bromofuran-2-yl)prop-2-enoic acid |
| InChIKey | IIMYTCICBUBFJH-DUXPYHPUSA-N |
| SMILES | C1=C(OC(=C1)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(5-bromofuran-2-yl)prop-2-enoic acid, 3-(5-Bromo-furan-2-yl)-acrylic acid, 3-(5-bromofuran-2-yl)prop-2-enoic acid, (E)-3-(5-bromofuran-2-yl)prop-2-enoic acid, 3-(5-bromofuran-2-yl)acrylic acid, (2E)-3-(5-bromofuran-2-yl)prop-2-enoic acid, E, (E)-3-(5-Bromo-2-furanyl)acrylic Acid, trans-3-(5-bromofuran-2-yl)propenoic acid, 2-Propenoic acid, 3-(5-bromo-2-furanyl)-, 3-(5-Bromo-2-furanyl)acrylic Acid