CAS 82299-36-3 appears in our catalog under these names: 5-Bromobenzo[d][1,3]dioxol-4-ol, 95%, 5-Bromo-2H-1,3-benzodioxol-4-ol, 98%, 98%, 5-Bromo-2H-1,3-benzodioxol-4-ol. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
5-bromo-1,3-benzodioxol-4-ol (CAS 82299-36-3) is a chemical compound with the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. IUPAC name: 5-bromo-1,3-benzodioxol-4-ol. InChIKey: FSDSDUFDWODBBX-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO3 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 5-bromo-1,3-benzodioxol-4-ol |
| InChIKey | FSDSDUFDWODBBX-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)O |
Computed by PubChem (NCBI)