CAS 959756-18-4 appears in our catalog under these names: 1H-Isoindol-1-one, 5-bromo-2,3-dihydro-3,3-dimethyl-, 95%, 5-Bromo-3,3-dimethyl-isoindolin-1-one, 95%, 95%, 1H-ISOINDOL-1-ONE, 5-BROMO-2,3-DIHYDRO-3,3-DIMETHYL-, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
5-bromo-3,3-dimethyl-2H-isoindol-1-one (CAS 959756-18-4) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 5-bromo-3,3-dimethyl-2H-isoindol-1-one. InChIKey: UQWABTUVMQZARA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 5-bromo-3,3-dimethyl-2H-isoindol-1-one |
| InChIKey | UQWABTUVMQZARA-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)C(=O)N1)C |
Computed by PubChem (NCBI)