cas: 1000577-76-3 — see every product listed under this CAS number, including other names
5-Bromo-3-chloro-2-fluorobenzonitrile 95% (CAS 1000577-76-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A497059-100mg |
| cas | 1000577-76-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 843.19 Pln | |
| Ambeed | 5g | 3479.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A497059 |
5-bromo-3-chloro-2-fluorobenzonitrile (CAS 1000577-76-3) is a chemical compound with the molecular formula C7H2BrClFN and a molecular weight of 234.45 g/mol. IUPAC name: 5-bromo-3-chloro-2-fluorobenzonitrile. InChIKey: CFAJQDDAWJDDIX-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClFN |
|---|---|
| Molecular weight | 234.45 g/mol |
| IUPAC name | 5-bromo-3-chloro-2-fluorobenzonitrile |
| InChIKey | CFAJQDDAWJDDIX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)F)Cl)Br |
Computed by PubChem (NCBI)