cas: 2404733-96-4 — see every product listed under this CAS number, including other names
5-Bromo-3-chloro-2-methoxyisonicotinic acid, 98% (CAS 2404733-96-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1632362-10g |
| cas | 2404733-96-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 50170.96 Pln | |
| AmBeed | 5g | 29521.24 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-3-chloro-2-methoxypyridine-4-carboxylic acid (CAS 2404733-96-4) is a chemical compound with the molecular formula C7H5BrClNO3 and a molecular weight of 266.47 g/mol. IUPAC name: 5-bromo-3-chloro-2-methoxypyridine-4-carboxylic acid. InChIKey: YZEBDKHUOGWKOK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO3 |
|---|---|
| Molecular weight | 266.47 g/mol |
| IUPAC name | 5-bromo-3-chloro-2-methoxypyridine-4-carboxylic acid |
| InChIKey | YZEBDKHUOGWKOK-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1Cl)C(=O)O)Br |
Computed by PubChem (NCBI)