CAS 917562-21-1 appears in our catalog under these names: 4-Bromo-3-chloro-6-nitroanisole, 95%, 4-Bromo-3-chloro-6-nitroanisole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 100g, 5g, 1g.
1-bromo-2-chloro-4-methoxy-5-nitrobenzene (CAS 917562-21-1) is a chemical compound with the molecular formula C7H5BrClNO3 and a molecular weight of 266.47 g/mol. IUPAC name: 1-bromo-2-chloro-4-methoxy-5-nitrobenzene. InChIKey: CLOMPIIPEQKLRX-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO3 |
|---|---|
| Molecular weight | 266.47 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-methoxy-5-nitrobenzene |
| InChIKey | CLOMPIIPEQKLRX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)