Products 2404733-96-4
CAS 2404733-96-4 appears in our catalog under these names: 5-Bromo-3-chloro-2-methoxyisonicotinic acid, 95%, 5-Bromo-3-chloro-2-methoxyisonicotinic acid, 98%, 5-Bromo-3-chloro-2-methoxyisonicotinic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
5-bromo-3-chloro-2-methoxypyridine-4-carboxylic acid (CAS 2404733-96-4) is a chemical compound with the molecular formula C7H5BrClNO3 and a molecular weight of 266.47 g/mol. IUPAC name: 5-bromo-3-chloro-2-methoxypyridine-4-carboxylic acid. InChIKey: YZEBDKHUOGWKOK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO3 |
|---|---|
| Molecular weight | 266.47 g/mol |
| IUPAC name | 5-bromo-3-chloro-2-methoxypyridine-4-carboxylic acid |
| InChIKey | YZEBDKHUOGWKOK-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1Cl)C(=O)O)Br |
Computed by PubChem (NCBI)