CAS 304876-05-9 appears in our catalog under these names: 5-Bromo-3-ethylindolin-2-one, 97%, 97%, 5-bromo-3-ethyl-2,3-dihydro-1H-indol-2-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-3-ethyl-1,3-dihydroindol-2-one (CAS 304876-05-9) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 5-bromo-3-ethyl-1,3-dihydroindol-2-one. InChIKey: VCFJZJWPWMXDAH-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 5-bromo-3-ethyl-1,3-dihydroindol-2-one |
| InChIKey | VCFJZJWPWMXDAH-UHFFFAOYSA-N |
| SMILES | CCC1C2=C(C=CC(=C2)Br)NC1=O |
Computed by PubChem (NCBI)