cas: 1142191-66-9 — see every product listed under this CAS number, including other names
5-Bromo-3-methoxypicolinic acid 95% (CAS 1142191-66-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199667-250mg |
| cas | 1142191-66-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 1015.62 Pln | |
| Ambeed | 25g | 3340.75 Pln | |
| Ambeed | 100g | 10855.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199667 |
5-bromo-3-methoxypyridine-2-carboxylic acid (CAS 1142191-66-9) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-3-methoxypyridine-2-carboxylic acid. InChIKey: UTRZGSGCVSZCCL-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-3-methoxypyridine-2-carboxylic acid |
| InChIKey | UTRZGSGCVSZCCL-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)