Products 1256810-07-7
CAS 1256810-07-7 appears in our catalog under these names: 6-Bromo-5-methoxypyridine-3-carboxylic acid, 95%, 6-Bromo-5-methoxynicotinic acid, 97%, 6-Bromo-5-methoxynicotinic acid, ≥95%, ≥95%, 6-Bromo-5-methoxypyridine-3-carboxylic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 25g.
6-bromo-5-methoxypyridine-3-carboxylic acid (CAS 1256810-07-7) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 6-bromo-5-methoxypyridine-3-carboxylic acid. InChIKey: AQZZZZIRQPMGSY-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 6-bromo-5-methoxypyridine-3-carboxylic acid |
| InChIKey | AQZZZZIRQPMGSY-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)