CAS 886365-22-6 appears in our catalog under these names: 5-Bromo-2-methoxy-isonicotinic acid, 97%, 5-Bromo-2-methoxy-isonicotinic acid, 5-Bromo-2-methoxyisonicotinic acid, 97%, 97%, 5-Bromo-2-methoxyisonicotinic acid, 95%, 5-Bromo-2-methoxyisonicotinic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 2,5g, 100mg.
5-bromo-2-methoxypyridine-4-carboxylic acid (CAS 886365-22-6) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-2-methoxypyridine-4-carboxylic acid. InChIKey: JZBHBRMXZANNNF-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-2-methoxypyridine-4-carboxylic acid |
| InChIKey | JZBHBRMXZANNNF-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)