cas: 50638-08-9 — see every product listed under this CAS number, including other names
5-Bromo-3-methyl-benzofuran-2-carboxylic acid, 97% (CAS 50638-08-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F345124-250MG |
| cas | 50638-08-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1528.65 Pln | |
| Fluorochem | 10g | 3002.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-3-methyl-1-benzofuran-2-carboxylic acid (CAS 50638-08-9) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 5-bromo-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: XXPAQRBXERJCQH-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | 5-bromo-3-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | XXPAQRBXERJCQH-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)