Products 866848-85-3

CAS 866848-85-3 is the registry number for 6-Bromo-1-oxo-2,3-dihydro-1h-indene-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-bromo-1-oxo-2,3-dihydroindene-4-carboxylic acid (CAS 866848-85-3) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 6-bromo-1-oxo-2,3-dihydroindene-4-carboxylic acid. InChIKey: OIDIHMHLTYUHPH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7BrO3
Molecular weight255.06 g/mol
IUPAC name6-bromo-1-oxo-2,3-dihydroindene-4-carboxylic acid
InChIKeyOIDIHMHLTYUHPH-UHFFFAOYSA-N
SMILESC1CC(=O)C2=C1C(=CC(=C2)Br)C(=O)O

Computed by PubChem (NCBI)