CAS 866848-85-3 is the registry number for 6-Bromo-1-oxo-2,3-dihydro-1h-indene-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-1-oxo-2,3-dihydroindene-4-carboxylic acid (CAS 866848-85-3) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 6-bromo-1-oxo-2,3-dihydroindene-4-carboxylic acid. InChIKey: OIDIHMHLTYUHPH-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | 6-bromo-1-oxo-2,3-dihydroindene-4-carboxylic acid |
| InChIKey | OIDIHMHLTYUHPH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)