CAS 1273596-20-5 appears in our catalog under these names: 7-Bromo-3-oxo-2,3-dihydro-1h-indene-5-carboxylic acid, 95%, 7-Bromo-3-oxo-2,3-dihydro-1H-indene-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid (CAS 1273596-20-5) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid. InChIKey: HYDNZQPQWFHSEP-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | 7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid |
| InChIKey | HYDNZQPQWFHSEP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)