cas: 234443-22-2 — see every product listed under this CAS number, including other names
5-Bromo-4,4,5,5-tetrafluoropentanoic acid 99% (CAS 234443-22-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A367683-250mg |
| cas | 234443-22-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1199.19 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A367683 |
5-bromo-4,4,5,5-tetrafluoropentanoic acid (CAS 234443-22-2) is a chemical compound with the molecular formula C5H5BrF4O2 and a molecular weight of 252.99 g/mol. IUPAC name: 5-bromo-4,4,5,5-tetrafluoropentanoic acid. InChIKey: OIIFPRVLJLLMOZ-UHFFFAOYSA-N.
| Molecular formula | C5H5BrF4O2 |
|---|---|
| Molecular weight | 252.99 g/mol |
| IUPAC name | 5-bromo-4,4,5,5-tetrafluoropentanoic acid |
| InChIKey | OIIFPRVLJLLMOZ-UHFFFAOYSA-N |
| SMILES | C(CC(C(F)(F)Br)(F)F)C(=O)O |
Computed by PubChem (NCBI)