cas: 234443-22-2 — see every product listed under this CAS number, including other names
5-Bromo-4,4,5,5-tetrafluoropentanoic acid, 99% (CAS 234443-22-2) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A367683-25g |
| cas | 234443-22-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 5590.48 Pln |
| purity | 99% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-4,4,5,5-tetrafluoropentanoic acid (CAS 234443-22-2) is a chemical compound with the molecular formula C5H5BrF4O2 and a molecular weight of 252.99 g/mol. IUPAC name: 5-bromo-4,4,5,5-tetrafluoropentanoic acid. InChIKey: OIIFPRVLJLLMOZ-UHFFFAOYSA-N.
| Molecular formula | C5H5BrF4O2 |
|---|---|
| Molecular weight | 252.99 g/mol |
| IUPAC name | 5-bromo-4,4,5,5-tetrafluoropentanoic acid |
| InChIKey | OIIFPRVLJLLMOZ-UHFFFAOYSA-N |
| SMILES | C(CC(C(F)(F)Br)(F)F)C(=O)O |
Computed by PubChem (NCBI)