cas: 234443-22-2 — see every product listed under this CAS number, including other names
5-Bromo-4,4,5,5-tetrafluoropentanoic acid, 99%, 99% (CAS 234443-22-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113N06-250mg |
| cas | 234443-22-2 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 971.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
5-bromo-4,4,5,5-tetrafluoropentanoic acid (CAS 234443-22-2) is a chemical compound with the molecular formula C5H5BrF4O2 and a molecular weight of 252.99 g/mol. IUPAC name: 5-bromo-4,4,5,5-tetrafluoropentanoic acid. InChIKey: OIIFPRVLJLLMOZ-UHFFFAOYSA-N.
| Molecular formula | C5H5BrF4O2 |
|---|---|
| Molecular weight | 252.99 g/mol |
| IUPAC name | 5-bromo-4,4,5,5-tetrafluoropentanoic acid |
| InChIKey | OIIFPRVLJLLMOZ-UHFFFAOYSA-N |
| SMILES | C(CC(C(F)(F)Br)(F)F)C(=O)O |
Computed by PubChem (NCBI)