5-Bromo-4-chloro-1H-pyrazolo[3,4-b]pyridine, 97%
cas: 1034769-88-4 — see every product listed under this CAS number, including other names
5-Bromo-4-chloro-1H-pyrazolo[3,4-b]pyridine, 97% (CAS 1034769-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F231220-100MG |
| cas | 1034769-88-4 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 695.61 Pln | |
| Fluorochem | 100mg | 976.76 Pln | |
| Fluorochem | 250mg | 2257.56 Pln | |
| Fluorochem | 500mg | 3132.25 Pln | |
| Fluorochem | 1g | 4387.01 Pln | |
| Fluorochem | 5g | 12759.07 Pln | |
| Fluorochem | 10g | 21209.22 Pln | |
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 1043.60 Pln | |
| Chemat | 500mg | 1864.40 Pln | |
| Chemat | 1g | 2632.40 Pln | |
| Chemat | 5g | 7778.00 Pln | |
| Chemat | 10g | 12918.80 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
5-bromo-4-chloro-1H-pyrazolo[3,4-b]pyridine (CAS 1034769-88-4) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 5-bromo-4-chloro-1H-pyrazolo[3,4-b]pyridine. InChIKey: LFIOULNHNXMRCP-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 5-bromo-4-chloro-1H-pyrazolo[3,4-b]pyridine |
| InChIKey | LFIOULNHNXMRCP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C=NNC2=N1)Cl)Br |
Computed by PubChem (NCBI)