cas: 1131604-99-3 — see every product listed under this CAS number, including other names
5-Bromo-4-chloropyridine-2,3-diamine (CAS 1131604-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091864-100MG |
| cas | 1131604-99-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 2549.12 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-4-chloropyridine-2,3-diamine (CAS 1131604-99-3) is a chemical compound with the molecular formula C5H5BrClN3 and a molecular weight of 222.47 g/mol. IUPAC name: 5-bromo-4-chloropyridine-2,3-diamine. InChIKey: IWPLIMBNUFTLIL-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClN3 |
|---|---|
| Molecular weight | 222.47 g/mol |
| IUPAC name | 5-bromo-4-chloropyridine-2,3-diamine |
| InChIKey | IWPLIMBNUFTLIL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)N)Cl)Br |
Computed by PubChem (NCBI)