CAS 163452-78-6 appears in our catalog under these names: 5–Bromo–2–chloropyridine–3,4–diamine, 5-Bromo-2-chloropyridine-3,4-diamine 97%, 3,4-Pyridinediamine, 5-bromo-2-chloro-, 97%, 97%, 5-Bromo-2-chloropyridine-3,4-diamine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
5-bromo-2-chloropyridine-3,4-diamine (CAS 163452-78-6) is a chemical compound with the molecular formula C5H5BrClN3 and a molecular weight of 222.47 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3,4-diamine. InChIKey: IFEZDSVRWYQAJR-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClN3 |
|---|---|
| Molecular weight | 222.47 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3,4-diamine |
| InChIKey | IFEZDSVRWYQAJR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)N)N)Br |
Computed by PubChem (NCBI)