CAS 1131604-99-3 appears in our catalog under these names: 5-Bromo-4-chloropyridine-2,3-diamine, 98%, 5-Bromo-4-chloropyridine-2,3-diamine, 97%, 5-Bromo-4-chloropyridine-2,3-diamine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
5-bromo-4-chloropyridine-2,3-diamine (CAS 1131604-99-3) is a chemical compound with the molecular formula C5H5BrClN3 and a molecular weight of 222.47 g/mol. IUPAC name: 5-bromo-4-chloropyridine-2,3-diamine. InChIKey: IWPLIMBNUFTLIL-UHFFFAOYSA-N.
| Molecular formula | C5H5BrClN3 |
|---|---|
| Molecular weight | 222.47 g/mol |
| IUPAC name | 5-bromo-4-chloropyridine-2,3-diamine |
| InChIKey | IWPLIMBNUFTLIL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)N)Cl)Br |
Computed by PubChem (NCBI)