cas: 2404734-29-6 — see every product listed under this CAS number, including other names
5-Bromo-4-ethoxy-2,3-difluorobenzoic acid (CAS 2404734-29-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629789-1G |
| cas | 2404734-29-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3621.66 Pln | |
| Fluorochem | 5g | 10712.91 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-4-ethoxy-2,3-difluorobenzoic acid (CAS 2404734-29-6) is a chemical compound with the molecular formula C9H7BrF2O3 and a molecular weight of 281.05 g/mol. IUPAC name: 5-bromo-4-ethoxy-2,3-difluorobenzoic acid. InChIKey: HLBNXDKSCHJIIR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O3 |
|---|---|
| Molecular weight | 281.05 g/mol |
| IUPAC name | 5-bromo-4-ethoxy-2,3-difluorobenzoic acid |
| InChIKey | HLBNXDKSCHJIIR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1F)F)C(=O)O)Br |
Computed by PubChem (NCBI)