Products 2404734-29-6
CAS 2404734-29-6 appears in our catalog under these names: 5-Bromo-4-ethoxy-2,3-difluorobenzoic acid, 95%, 5-Bromo-4-ethoxy-2,3-difluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-bromo-4-ethoxy-2,3-difluorobenzoic acid (CAS 2404734-29-6) is a chemical compound with the molecular formula C9H7BrF2O3 and a molecular weight of 281.05 g/mol. IUPAC name: 5-bromo-4-ethoxy-2,3-difluorobenzoic acid. InChIKey: HLBNXDKSCHJIIR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O3 |
|---|---|
| Molecular weight | 281.05 g/mol |
| IUPAC name | 5-bromo-4-ethoxy-2,3-difluorobenzoic acid |
| InChIKey | HLBNXDKSCHJIIR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1F)F)C(=O)O)Br |
Computed by PubChem (NCBI)