CAS 2091796-40-4 is the registry number for Methyl 5-bromo-2,3-difluoro-4-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 5-bromo-2,3-difluoro-4-methoxybenzoate (CAS 2091796-40-4) is a chemical compound with the molecular formula C9H7BrF2O3 and a molecular weight of 281.05 g/mol. IUPAC name: methyl 5-bromo-2,3-difluoro-4-methoxybenzoate. InChIKey: INSGYEXZOJENAH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O3 |
|---|---|
| Molecular weight | 281.05 g/mol |
| IUPAC name | methyl 5-bromo-2,3-difluoro-4-methoxybenzoate |
| InChIKey | INSGYEXZOJENAH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)F)C(=O)OC)Br |
Computed by PubChem (NCBI)