cas: 6943-69-7 — see every product listed under this CAS number, including other names
5-Bromo-4-methoxy-2-nitroaniline 98% (CAS 6943-69-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117762-10g |
| cas | 6943-69-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 4497.75 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 993.38 Pln | |
| Ambeed | 5g | 2834.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A117762 |
5-bromo-4-methoxy-2-nitroaniline (CAS 6943-69-7) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 5-bromo-4-methoxy-2-nitroaniline. InChIKey: HQUCUBOXGLEYNA-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 5-bromo-4-methoxy-2-nitroaniline |
| InChIKey | HQUCUBOXGLEYNA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])N)Br |
Computed by PubChem (NCBI)