cas: 1089281-86-6 — see every product listed under this CAS number, including other names
5-Bromo-4-methyl-2-nitroanisole 98% (CAS 1089281-86-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A262795-250mg |
| cas | 1089281-86-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 854.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A262795 |
1-bromo-5-methoxy-2-methyl-4-nitrobenzene (CAS 1089281-86-6) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 1-bromo-5-methoxy-2-methyl-4-nitrobenzene. InChIKey: RSQRVVVHNGPSGG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 1-bromo-5-methoxy-2-methyl-4-nitrobenzene |
| InChIKey | RSQRVVVHNGPSGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)