CAS 1784018-79-6 is the registry number for 5-Bromo-7-methoxy-1-methyl-1H-indazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromo-7-methoxy-1-methylindazole (CAS 1784018-79-6) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-7-methoxy-1-methylindazole. InChIKey: VJPJSIRLUPBZED-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-7-methoxy-1-methylindazole |
| InChIKey | VJPJSIRLUPBZED-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2OC)Br)C=N1 |
Computed by PubChem (NCBI)