cas: 1224604-14-1 — see every product listed under this CAS number, including other names
5-Bromo-N-methoxy-N,3-dimethylpicolinamide, ≥95%, ≥95% (CAS 1224604-14-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112802-1g |
| cas | 1224604-14-1 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1240.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-N-methoxy-N,3-dimethylpyridine-2-carboxamide (CAS 1224604-14-1) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: 5-bromo-N-methoxy-N,3-dimethylpyridine-2-carboxamide. InChIKey: JQCNTQDJDARJAQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 5-bromo-N-methoxy-N,3-dimethylpyridine-2-carboxamide |
| InChIKey | JQCNTQDJDARJAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)N(C)OC)Br |
Computed by PubChem (NCBI)