CAS 1224604-14-1 appears in our catalog under these names: 5-Bromo-3-methyl-n-methoxy-n-methylpyridine-2-carboxamide, 95%, 5-Bromo-N-methoxy-N,3-dimethylpicolinamide, ≥95%, ≥95%, 5-Bromo-3-methyl-N-methoxy-N-methylpyridine-2-carboxamide. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-bromo-N-methoxy-N,3-dimethylpyridine-2-carboxamide (CAS 1224604-14-1) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: 5-bromo-N-methoxy-N,3-dimethylpyridine-2-carboxamide. InChIKey: JQCNTQDJDARJAQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 5-bromo-N-methoxy-N,3-dimethylpyridine-2-carboxamide |
| InChIKey | JQCNTQDJDARJAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)N(C)OC)Br |
Computed by PubChem (NCBI)