CAS 1423037-41-5 is the registry number for Ethyl 3,4-diamino-5-bromobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Ethyl 3,4-diamino-5-bromobenzoate (CAS 1423037-41-5) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: ethyl 3,4-diamino-5-bromobenzoate. InChIKey: QAQXPVWOWDLLFT-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | ethyl 3,4-diamino-5-bromobenzoate |
| InChIKey | QAQXPVWOWDLLFT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Br)N)N |
Computed by PubChem (NCBI)