cas: 24050-49-5 — see every product listed under this CAS number, including other names
5-Bromobenzo[de]isochromene-1,3-dione, 96% (CAS 24050-49-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222794-250MG |
| cas | 24050-49-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 2.5g | 690.40 Pln | |
| Fluorochem | 5g | 955.93 Pln | |
| Fluorochem | 25g | 3257.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 24050-49-5) is a chemical compound with the molecular formula C12H5BrO3 and a molecular weight of 277.07 g/mol. IUPAC name: 7-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: LYXFXCSFCWZGNZ-UHFFFAOYSA-N.
| Molecular formula | C12H5BrO3 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | 7-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | LYXFXCSFCWZGNZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C(=O)OC3=O)Br |
Computed by PubChem (NCBI)