CAS 21563-29-1 appears in our catalog under these names: 4-Bromobenzo[de]isochromene-1,3-dione, 95%, 4-Bromobenzo(de)isochromene-1,3-dione, 97%, 4-Bromobenzo[de]isochromene-1,3-dione, 99%, 99%, 4-Bromobenzo[de]isochromene-1,3-dione, 99%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1kg, 500g, 50g, 75g, 200g.
6-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (CAS 21563-29-1) is a chemical compound with the molecular formula C12H5BrO3 and a molecular weight of 277.07 g/mol. IUPAC name: 6-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione. InChIKey: TZUREPOYENXNME-UHFFFAOYSA-N.
| Molecular formula | C12H5BrO3 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | 6-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| InChIKey | TZUREPOYENXNME-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)OC(=O)C3=C(C=C2)Br |
Computed by PubChem (NCBI)