CAS 24050-49-5 appears in our catalog under these names: 5-Bromobenzo[de]isochromene-1,3-dione 95%, 5-Bromobenzo[de]isochromene-1,3-dione, 96%, 3-Bromo-1,8-naphthalic anhydride, 97%, 3-Bromo-1,8-naphthalic Anhydride, 3-Bromo-1,8-naphthalic anhydride, 97% . Offered by: Ambeed, Fluorochem, Combi-blocks, TRC, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 2.5g, 10g.
7-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 24050-49-5) is a chemical compound with the molecular formula C12H5BrO3 and a molecular weight of 277.07 g/mol. IUPAC name: 7-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: LYXFXCSFCWZGNZ-UHFFFAOYSA-N.
| Molecular formula | C12H5BrO3 |
|---|---|
| Molecular weight | 277.07 g/mol |
| IUPAC name | 7-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | LYXFXCSFCWZGNZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C(=O)OC3=O)Br |
Computed by PubChem (NCBI)