cas: 26028-36-4 — see every product listed under this CAS number, including other names
5-Bromobenzofuran-2-carboxylic acid methyl ester, 98% (CAS 26028-36-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-4882-5g |
| cas | 26028-36-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 607.10 Pln | |
| Fluorochem | 5g | 1002.79 Pln | |
| Fluorochem | 10g | 1736.91 Pln | |
| Fluorochem | 25g | 3423.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 5-bromo-1-benzofuran-2-carboxylate (CAS 26028-36-4) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: methyl 5-bromo-1-benzofuran-2-carboxylate. InChIKey: ZZDBMDNRQQDSKG-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | methyl 5-bromo-1-benzofuran-2-carboxylate |
| InChIKey | ZZDBMDNRQQDSKG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)