cas: 321352-52-7 — see every product listed under this CAS number, including other names
5-Bromoindan-2-ylamine hydrobromide, 98%, 98% (CAS 321352-52-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GGN-500g |
| cas | 321352-52-7 |
| size | 500g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 8784.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 611.60 Pln | |
| Chemat | 50g | 1130.00 Pln | |
| Chemat | 100g | 2128.40 Pln | |
| Chemat | 250g | 5022.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2,3-dihydro-1H-inden-2-amine;hydrobromide (CAS 321352-52-7) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1H-inden-2-amine;hydrobromide. InChIKey: WVNGAALXGMXZJI-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1H-inden-2-amine;hydrobromide |
| InChIKey | WVNGAALXGMXZJI-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)Br)N.Br |
Computed by PubChem (NCBI)