cas: 64169-34-2 — see every product listed under this CAS number, including other names
5-Bromophthalide, 98% (CAS 64169-34-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 10g, 15g, 1g, 500g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 373330250 |
| cas | 64169-34-2 |
| size | 25g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 592.44 Pln | |
| Thermo Scientific (Acros) | 100g | 2628.13 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 15g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 117.68 Pln | |
| Fluorochem | 100g | 279.09 Pln | |
| Fluorochem | 500g | 919.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
5-bromo-3H-2-benzofuran-1-one (CAS 64169-34-2) is a chemical compound with the molecular formula C8H5BrO2 and a molecular weight of 213.03 g/mol. IUPAC name: 5-bromo-3H-2-benzofuran-1-one. InChIKey: IUSPXLCLQIZFHL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO2 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 5-bromo-3H-2-benzofuran-1-one |
| InChIKey | IUSPXLCLQIZFHL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(=O)O1 |
Computed by PubChem (NCBI)