cas: 1156753-55-7 — see every product listed under this CAS number, including other names
5-Chloro-1-ethyl-1H-benzimidazol-2-amine (CAS 1156753-55-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F718541-100MG |
| cas | 1156753-55-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1913.93 Pln | |
| Fluorochem | 250mg | 2236.73 Pln | |
| Fluorochem | 1g | 4527.59 Pln |
| delivery time | 3-4 weeks |
|---|
5-chloro-1-ethylbenzimidazol-2-amine (CAS 1156753-55-7) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 5-chloro-1-ethylbenzimidazol-2-amine. InChIKey: IENZKHQOAZUDKM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 5-chloro-1-ethylbenzimidazol-2-amine |
| InChIKey | IENZKHQOAZUDKM-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Cl)N=C1N |
Computed by PubChem (NCBI)