cas: 1156753-55-7 — see every product listed under this CAS number, including other names
5-chloro-1-ethyl-1H-1,3-benzodiazol-2-amine, ≥95%, ≥95% (CAS 1156753-55-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A5B3-100mg |
| cas | 1156753-55-7 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1173.20 Pln | |
| Chemat | 250mg | 1370.00 Pln | |
| Chemat | 1g | 2747.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-1-ethylbenzimidazol-2-amine (CAS 1156753-55-7) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 5-chloro-1-ethylbenzimidazol-2-amine. InChIKey: IENZKHQOAZUDKM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 5-chloro-1-ethylbenzimidazol-2-amine |
| InChIKey | IENZKHQOAZUDKM-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Cl)N=C1N |
Computed by PubChem (NCBI)