cas: 42098-25-9 — see every product listed under this CAS number, including other names
5-Chloro-1-methyl-4-nitro-1H-pyrazole, 95% (CAS 42098-25-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215347-100MG |
| cas | 42098-25-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1185.02 Pln | |
| Fluorochem | 10g | 2200.28 Pln | |
| Fluorochem | 25g | 3215.55 Pln | |
| Fluorochem | 100g | 10296.39 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-1-methyl-4-nitropyrazole (CAS 42098-25-9) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 161.55 g/mol. IUPAC name: 5-chloro-1-methyl-4-nitropyrazole. InChIKey: POXLZEWCWNUVDW-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O2 |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | 5-chloro-1-methyl-4-nitropyrazole |
| InChIKey | POXLZEWCWNUVDW-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)