cas: 4897-25-0 — see every product listed under this CAS number, including other names
5-Chloro-1-methyl-4-nitroimidazole, 97% (CAS 4897-25-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005947-1G |
| cas | 4897-25-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 138.51 Pln | |
| Fluorochem | 100g | 253.05 Pln | |
| Fluorochem | 500g | 914.28 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
5-chloro-1-methyl-4-nitroimidazole (CAS 4897-25-0) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 161.55 g/mol. IUPAC name: 5-chloro-1-methyl-4-nitroimidazole. InChIKey: OSJUNMSWBBOTQU-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O2 |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | 5-chloro-1-methyl-4-nitroimidazole |
| InChIKey | OSJUNMSWBBOTQU-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)